C12H16Br2ClN3 — CID 120660850
(3aR,6aS)-5-[(3,5-dibromo-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660850) has the molecular formula C12H16Br2ClN3 and a molecular weight of 397.54 g/mol. Its IUPAC name is (3aR,6aS)-5-[(3,5-dibromo-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(3,5-dibromo-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660850 |
| Molecular Formula | C12H16Br2ClN3 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | (3aR,6aS)-5-[(3,5-dibromo-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Brc1cnc(CN2C[C@H]3CNC[C@H]3C2)c(Br)c1.Cl |
| InChI | InChI=1S/C12H15Br2N3.ClH/c13-10-1-11(14)12(16-4-10)7-17-5-8-2-15-3-9(8)6-17;/h1,4,8-9,15H,2-3,5-7H2;1H/t8-,9+; |
| InChIKey | ZWTGCPVPFAQVFK-UFIFRZAQSA-N |
| XLogP | 2.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |