C12H17ClFN3 — CID 120660916
(3aR,6aS)-5-[(5-fluoro-3-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660916) has the molecular formula C12H17ClFN3 and a molecular weight of 257.74 g/mol. Its IUPAC name is (3aR,6aS)-5-[(5-fluoro-3-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(5-fluoro-3-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660916 |
| Molecular Formula | C12H17ClFN3 |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (3aR,6aS)-5-[(5-fluoro-3-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cl.Fc1cncc(CN2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C12H16FN3.ClH/c13-12-1-9(2-14-5-12)6-16-7-10-3-15-4-11(10)8-16;/h1-2,5,10-11,15H,3-4,6-8H2;1H/t10-,11+; |
| InChIKey | SZJPJKVNZFGSEE-NJJJQDLFSA-N |
| XLogP | 1.29 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |