C16H19Cl2N3 — CID 120661005
8-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chloroquinoline;hydrochloride (PubChem CID 120661005) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.25 g/mol. Its IUPAC name is 8-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chloroquinoline;hydrochloride.
| Compound Name | 8-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chloroquinoline;hydrochloride |
|---|---|
| PubChem CID | 120661005 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 8-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-5-chloroquinoline;hydrochloride |
| SMILES | Cl.Clc1ccc(CN2C[C@H]3CNC[C@H]3C2)c2ncccc12 |
| InChI | InChI=1S/C16H18ClN3.ClH/c17-15-4-3-11(16-14(15)2-1-5-19-16)8-20-9-12-6-18-7-13(12)10-20;/h1-5,12-13,18H,6-10H2;1H/t12-,13+; |
| InChIKey | UARZJENKSCSMSM-OEEJBDNKSA-N |
| XLogP | 2.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |