About N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide
N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide (PubChem CID 120661578) has the molecular formula C8H15F2N3O
and a molecular weight of 207.22 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide |
| PubChem CID | 120661578 |
| Molecular Formula | C8H15F2N3O |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CC(F)F)CCO1 |
| InChI | InChI=1S/C8H15F2N3O/c1-6-5-13(2-3-14-6)8(11)12-4-7(9)10/h6-7H,2-5H2,1H3,(H2,11,12) |
| InChIKey | FTWQWXRUEBXPRP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide?
The IUPAC name of N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide (CID 120661578) is N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide?
The canonical SMILES for N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide is CC1CN(/C(N)=N/CC(F)F)CCO1.
What is the InChIKey of N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide?
The InChIKey is FTWQWXRUEBXPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2N3O/c1-6-5-13(2-3-14-6)8(11)12-4-7(9)10/h6-7H,2-5H2,1H3,(H2,11,12).
What are the key properties of N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide?
N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide has a molecular weight of 207.22 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-2-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 120661578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).