C10H18F3N3O — CID 120662152
2-methyl-N'-(3,3,3-trifluoro-2-methylpropyl)morpholine-4-carboximidamide (PubChem CID 120662152) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-methyl-N'-(3,3,3-trifluoro-2-methylpropyl)morpholine-4-carboximidamide.
| Compound Name | 2-methyl-N'-(3,3,3-trifluoro-2-methylpropyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120662152 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-methyl-N'-(3,3,3-trifluoro-2-methylpropyl)morpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CC(C)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C10H18F3N3O/c1-7(10(11,12)13)5-15-9(14)16-3-4-17-8(2)6-16/h7-8H,3-6H2,1-2H3,(H2,14,15) |
| InChIKey | SRUDRHURZPIBBY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|