About N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide
N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120662208) has the molecular formula C10H19F2N3O2
and a molecular weight of 251.28 g/mol. Its IUPAC name is N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide |
| PubChem CID | 120662208 |
| Molecular Formula | C10H19F2N3O2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CCOCC(F)F)CCO1 |
| InChI | InChI=1S/C10H19F2N3O2/c1-8-6-15(3-5-17-8)10(13)14-2-4-16-7-9(11)12/h8-9H,2-7H2,1H3,(H2,13,14) |
| InChIKey | XCYXPLJMELSYKV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide?
The IUPAC name of N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide (CID 120662208) is N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide?
The canonical SMILES for N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide is CC1CN(/C(N)=N/CCOCC(F)F)CCO1.
What is the InChIKey of N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide?
The InChIKey is XCYXPLJMELSYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2N3O2/c1-8-6-15(3-5-17-8)10(13)14-2-4-16-7-9(11)12/h8-9H,2-7H2,1H3,(H2,13,14).
What are the key properties of N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide?
N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide has a molecular weight of 251.28 g/mol, XLogP of 0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2,2-difluoroethoxy)ethyl]-2-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 120662208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).