About 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene
1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene (PubChem CID 12066232) has the molecular formula C26H34
and a molecular weight of 346.56 g/mol. Its IUPAC name is 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene.
Molecular Properties
| Compound Name | 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene |
| PubChem CID | 12066232 |
| Molecular Formula | C26H34 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene |
| SMILES | C=CCC(CC=C)(CC=C)c1ccc(C(CC=C)(CC=C)CC=C)cc1 |
| InChI | InChI=1S/C26H34/c1-7-17-25(18-8-2,19-9-3)23-13-15-24(16-14-23)26(20-10-4,21-11-5)22-12-6/h7-16H,1-6,17-22H2 |
| InChIKey | UORICYPOCBGBDM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene?
The IUPAC name of 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene (CID 12066232) is 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene.
What is the SMILES notation for 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene?
The canonical SMILES for 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene is C=CCC(CC=C)(CC=C)c1ccc(C(CC=C)(CC=C)CC=C)cc1.
What is the InChIKey of 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene?
The InChIKey is UORICYPOCBGBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34/c1-7-17-25(18-8-2,19-9-3)23-13-15-24(16-14-23)26(20-10-4,21-11-5)22-12-6/h7-16H,1-6,17-22H2.
What are the key properties of 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene?
1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene has a molecular weight of 346.56 g/mol, XLogP of 7.62, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-prop-2-enylhepta-1,6-dien-4-yl)benzene is sourced from PubChem (CID 12066232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).