About 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine
2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine (PubChem CID 120662560) has the molecular formula C20H29F3N4
and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine.
Molecular Properties
| Compound Name | 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine |
| PubChem CID | 120662560 |
| Molecular Formula | C20H29F3N4 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NC1CC(N2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C20H29F3N4/c1-26(2)19(24-14-15-6-4-3-5-7-15)25-17-12-18(13-17)27-10-8-16(9-11-27)20(21,22)23/h3-7,16-18H,8-14H2,1-2H3,(H,24,25) |
| InChIKey | MHNFZOHIUCIBQJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine?
The IUPAC name of 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine (CID 120662560) is 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine.
What is the SMILES notation for 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine?
The canonical SMILES for 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine is CN(C)/C(=N\Cc1ccccc1)NC1CC(N2CCC(C(F)(F)F)CC2)C1.
What is the InChIKey of 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine?
The InChIKey is MHNFZOHIUCIBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F3N4/c1-26(2)19(24-14-15-6-4-3-5-7-15)25-17-12-18(13-17)27-10-8-16(9-11-27)20(21,22)23/h3-7,16-18H,8-14H2,1-2H3,(H,24,25).
What are the key properties of 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine?
2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine has a molecular weight of 382.47 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,1-dimethyl-3-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]guanidine is sourced from PubChem (CID 120662560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).