About 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide
2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide (PubChem CID 120663063) has the molecular formula C14H21BrIN3S
and a molecular weight of 470.22 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide |
| PubChem CID | 120663063 |
| Molecular Formula | C14H21BrIN3S |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide |
| SMILES | I.N/C(=N\[C@@H]1C[C@H]1c1ccc(Br)s1)NC1CCCCC1 |
| InChI | InChI=1S/C14H20BrN3S.HI/c15-13-7-6-12(19-13)10-8-11(10)18-14(16)17-9-4-2-1-3-5-9;/h6-7,9-11H,1-5,8H2,(H3,16,17,18);1H/t10-,11-;/m1./s1 |
| InChIKey | PNAADAJDYKTLSV-NDXYWBNTSA-N |
| XLogP | 4.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide?
The IUPAC name of 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide (CID 120663063) is 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide.
What is the SMILES notation for 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide?
The canonical SMILES for 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide is I.N/C(=N\[C@@H]1C[C@H]1c1ccc(Br)s1)NC1CCCCC1.
What is the InChIKey of 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide?
The InChIKey is PNAADAJDYKTLSV-NDXYWBNTSA-N. The full InChI is InChI=1S/C14H20BrN3S.HI/c15-13-7-6-12(19-13)10-8-11(10)18-14(16)17-9-4-2-1-3-5-9;/h6-7,9-11H,1-5,8H2,(H3,16,17,18);1H/t10-,11-;/m1./s1.
What are the key properties of 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide?
2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide has a molecular weight of 470.22 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-2-(5-bromothiophen-2-yl)cyclopropyl]-1-cyclohexylguanidine;hydroiodide is sourced from PubChem (CID 120663063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).