C18H23N5 — CID 120663100
2-(cyclobutylmethyl)-1-[(1R,2S)-2-(1-phenylpyrazol-4-yl)cyclopropyl]guanidine (PubChem CID 120663100) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[(1R,2S)-2-(1-phenylpyrazol-4-yl)cyclopropyl]guanidine.
| Compound Name | 2-(cyclobutylmethyl)-1-[(1R,2S)-2-(1-phenylpyrazol-4-yl)cyclopropyl]guanidine |
|---|---|
| PubChem CID | 120663100 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[(1R,2S)-2-(1-phenylpyrazol-4-yl)cyclopropyl]guanidine |
| SMILES | N/C(=N\CC1CCC1)N[C@@H]1C[C@H]1c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H23N5/c19-18(20-10-13-5-4-6-13)22-17-9-16(17)14-11-21-23(12-14)15-7-2-1-3-8-15/h1-3,7-8,11-13,16-17H,4-6,9-10H2,(H3,19,20,22)/t16-,17+/m0/s1 |
| InChIKey | USCYVSQOHOXDCT-DLBZAZTESA-N |
| XLogP | 2.43 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|