About [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane
[(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane (PubChem CID 12066316) has the molecular formula C17H30OSi2
and a molecular weight of 306.60 g/mol. Its IUPAC name is [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane.
Molecular Properties
| Compound Name | [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane |
| PubChem CID | 12066316 |
| Molecular Formula | C17H30OSi2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane |
| SMILES | C/C=C/CO[Si](C)(C)C#CCCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi2/c1-7-8-15-18-20(5,6)17-14-12-10-9-11-13-16-19(2,3)4/h7-8H,9-12,15H2,1-6H3/b8-7+ |
| InChIKey | CMKRESWKTMCKLE-BQYQJAHWSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane?
The IUPAC name of [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane (CID 12066316) is [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane.
What is the SMILES notation for [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane?
The canonical SMILES for [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane is C/C=C/CO[Si](C)(C)C#CCCCCC#C[Si](C)(C)C.
What is the InChIKey of [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane?
The InChIKey is CMKRESWKTMCKLE-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H30OSi2/c1-7-8-15-18-20(5,6)17-14-12-10-9-11-13-16-19(2,3)4/h7-8H,9-12,15H2,1-6H3/b8-7+.
What are the key properties of [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane?
[(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane has a molecular weight of 306.60 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enoxy]-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane is sourced from PubChem (CID 12066316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).