C14H22ClN3OS — CID 120663923
2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide;hydrochloride (PubChem CID 120663923) has the molecular formula C14H22ClN3OS and a molecular weight of 315.87 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120663923 |
| Molecular Formula | C14H22ClN3OS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
| SMILES | CN(Cc1cccs1)C(=O)CN1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C14H21N3OS.ClH/c1-16(9-13-3-2-4-19-13)14(18)10-17-7-11-5-15-6-12(11)8-17;/h2-4,11-12,15H,5-10H2,1H3;1H/t11-,12+; |
| InChIKey | NYXNLPCHYLZMNA-IWKKHLOMSA-N |
| XLogP | 1.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |