C13H23ClN2O3S — CID 120664287
N-(3-aminopropyl)-N-benzyl-2-methoxyethanesulfonamide;hydrochloride (PubChem CID 120664287) has the molecular formula C13H23ClN2O3S and a molecular weight of 322.86 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2-methoxyethanesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2-methoxyethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120664287 |
| Molecular Formula | C13H23ClN2O3S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2-methoxyethanesulfonamide;hydrochloride |
| SMILES | COCCS(=O)(=O)N(CCCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C13H22N2O3S.ClH/c1-18-10-11-19(16,17)15(9-5-8-14)12-13-6-3-2-4-7-13;/h2-4,6-7H,5,8-12,14H2,1H3;1H |
| InChIKey | MNWIITKFQTXVOT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |