C11H26ClN3O2S — CID 120664457
N-[(2R)-2-(ethylamino)propyl]-3-methylpiperidine-1-sulfonamide;hydrochloride (PubChem CID 120664457) has the molecular formula C11H26ClN3O2S and a molecular weight of 299.87 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3-methylpiperidine-1-sulfonamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3-methylpiperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120664457 |
| Molecular Formula | C11H26ClN3O2S |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3-methylpiperidine-1-sulfonamide;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)N1CCCC(C)C1.Cl |
| InChI | InChI=1S/C11H25N3O2S.ClH/c1-4-12-11(3)8-13-17(15,16)14-7-5-6-10(2)9-14;/h10-13H,4-9H2,1-3H3;1H/t10?,11-;/m1./s1 |
| InChIKey | MVVCQDRRKACWRS-PSDUUTOMSA-N |
| XLogP | 0.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |