C9H17FN2O2S — CID 120665252
(3aR,6aS)-5-(3-fluoropropylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120665252) has the molecular formula C9H17FN2O2S and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aR,6aS)-5-(3-fluoropropylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(3-fluoropropylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120665252 |
| Molecular Formula | C9H17FN2O2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3aR,6aS)-5-(3-fluoropropylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(CCCF)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C9H17FN2O2S/c10-2-1-3-15(13,14)12-6-8-4-11-5-9(8)7-12/h8-9,11H,1-7H2/t8-,9+ |
| InChIKey | YJEXZYDHKGDXCA-DTORHVGOSA-N |
| XLogP | -0.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |