C18H19BrFN3O — CID 120666120
2-[3-(3-bromo-4-fluorophenyl)cyclobutyl]-1-(3-methoxyphenyl)guanidine (PubChem CID 120666120) has the molecular formula C18H19BrFN3O and a molecular weight of 392.27 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-fluorophenyl)cyclobutyl]-1-(3-methoxyphenyl)guanidine.
| Compound Name | 2-[3-(3-bromo-4-fluorophenyl)cyclobutyl]-1-(3-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 120666120 |
| Molecular Formula | C18H19BrFN3O |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[3-(3-bromo-4-fluorophenyl)cyclobutyl]-1-(3-methoxyphenyl)guanidine |
| SMILES | COc1cccc(N/C(N)=N/C2CC(c3ccc(F)c(Br)c3)C2)c1 |
| InChI | InChI=1S/C18H19BrFN3O/c1-24-15-4-2-3-13(10-15)22-18(21)23-14-7-12(8-14)11-5-6-17(20)16(19)9-11/h2-6,9-10,12,14H,7-8H2,1H3,(H3,21,22,23) |
| InChIKey | DOKKNOMNZWMMTA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|