C18H21N3O2S — CID 120666745
2-amino-2-(4-methylphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 120666745) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-amino-2-(4-methylphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 120666745 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C(N)C(=O)N2CCN(C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-13-4-6-14(7-5-13)16(19)18(23)21-10-8-20(9-11-21)17(22)15-3-2-12-24-15/h2-7,12,16H,8-11,19H2,1H3 |
| InChIKey | ACMHBNKDAIPKGY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |