C20H25N3O2 — CID 120667141
3-[[2-amino-2-(4-methylphenyl)acetyl]amino]-N-tert-butylbenzamide (PubChem CID 120667141) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[[2-amino-2-(4-methylphenyl)acetyl]amino]-N-tert-butylbenzamide.
| Compound Name | 3-[[2-amino-2-(4-methylphenyl)acetyl]amino]-N-tert-butylbenzamide |
|---|---|
| PubChem CID | 120667141 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[[2-amino-2-(4-methylphenyl)acetyl]amino]-N-tert-butylbenzamide |
| SMILES | Cc1ccc(C(N)C(=O)Nc2cccc(C(=O)NC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-13-8-10-14(11-9-13)17(21)19(25)22-16-7-5-6-15(12-16)18(24)23-20(2,3)4/h5-12,17H,21H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | YDFUOFXJVWWDHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |