C16H24ClN3O2 — CID 120667266
2-amino-2-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide;hydrochloride (PubChem CID 120667266) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120667266 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCC(=O)N2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C16H23N3O2.ClH/c1-12-5-7-13(8-6-12)15(17)16(21)18-11-14(20)19-9-3-2-4-10-19;/h5-8,15H,2-4,9-11,17H2,1H3,(H,18,21);1H |
| InChIKey | WQCWJMUSLAXNGP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |