C19H25N3O3S — CID 120667680
2-amino-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylphenyl)acetamide (PubChem CID 120667680) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-amino-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-amino-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 120667680 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-amino-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)NC(C)c2ccc(S(=O)(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-13-5-7-16(8-6-13)18(20)19(23)21-14(2)15-9-11-17(12-10-15)26(24,25)22(3)4/h5-12,14,18H,20H2,1-4H3,(H,21,23) |
| InChIKey | ILTMWBOCQYLAOM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |