C19H30ClN3O2 — CID 120668147
2-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride (PubChem CID 120668147) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120668147 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCNC(=O)CC2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C19H29N3O2.ClH/c1-14-7-9-16(10-8-14)18(20)19(24)22-12-11-21-17(23)13-15-5-3-2-4-6-15;/h7-10,15,18H,2-6,11-13,20H2,1H3,(H,21,23)(H,22,24);1H |
| InChIKey | HBFSFHAXXFLVGL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|