C14H16O6 — CID 12066855
7-[3,4-dihydroxy-3-(hydroxymethyl)butoxy]chromen-2-one (PubChem CID 12066855) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 7-[3,4-dihydroxy-3-(hydroxymethyl)butoxy]chromen-2-one.
| Compound Name | 7-[3,4-dihydroxy-3-(hydroxymethyl)butoxy]chromen-2-one |
|---|---|
| PubChem CID | 12066855 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 7-[3,4-dihydroxy-3-(hydroxymethyl)butoxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(OCCC(O)(CO)CO)cc2o1 |
| InChI | InChI=1S/C14H16O6/c15-8-14(18,9-16)5-6-19-11-3-1-10-2-4-13(17)20-12(10)7-11/h1-4,7,15-16,18H,5-6,8-9H2 |
| InChIKey | ITCCTJJBRDDEIT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|