C14H21ClN2O — CID 120668819
2-amino-N-[(1-methylcyclopropyl)methyl]-2-(4-methylphenyl)acetamide;hydrochloride (PubChem CID 120668819) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-amino-N-[(1-methylcyclopropyl)methyl]-2-(4-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[(1-methylcyclopropyl)methyl]-2-(4-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120668819 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-N-[(1-methylcyclopropyl)methyl]-2-(4-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCC2(C)CC2)cc1.Cl |
| InChI | InChI=1S/C14H20N2O.ClH/c1-10-3-5-11(6-4-10)12(15)13(17)16-9-14(2)7-8-14;/h3-6,12H,7-9,15H2,1-2H3,(H,16,17);1H |
| InChIKey | RIMYHJQVGPFPKR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |