C13H19F6N3O4 — CID 12066939
tert-butyl N,N-bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate (PubChem CID 12066939) has the molecular formula C13H19F6N3O4 and a molecular weight of 395.30 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 12066939 |
| Molecular Formula | C13H19F6N3O4 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | tert-butyl N,N-bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNC(=O)C(F)(F)F)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F6N3O4/c1-11(2,3)26-10(25)22(6-4-20-8(23)12(14,15)16)7-5-21-9(24)13(17,18)19/h4-7H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | SWGSTLPUUCLPQU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |