C31H30N4O5 — CID 12066969
dimethyl 3,7-dimethyl-9-oxo-2,4-di(quinolin-2-yl)-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 12066969) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is dimethyl 3,7-dimethyl-9-oxo-2,4-di(quinolin-2-yl)-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl 3,7-dimethyl-9-oxo-2,4-di(quinolin-2-yl)-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 12066969 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | dimethyl 3,7-dimethyl-9-oxo-2,4-di(quinolin-2-yl)-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | COC(=O)C12CN(C)CC(C(=O)OC)(C1=O)C(c1ccc3ccccc3n1)N(C)C2c1ccc2ccccc2n1 |
| InChI | InChI=1S/C31H30N4O5/c1-34-17-30(28(37)39-3)25(23-15-13-19-9-5-7-11-21(19)32-23)35(2)26(31(18-34,27(30)36)29(38)40-4)24-16-14-20-10-6-8-12-22(20)33-24/h5-16,25-26H,17-18H2,1-4H3 |
| InChIKey | UHYKARPTRKJNJF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|