C20H27Cl2N3O — CID 120669772
2-amino-2-(4-methylphenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide;dihydrochloride (PubChem CID 120669772) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120669772 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCC2CCN(c3ccccc3)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O.2ClH/c1-15-7-9-17(10-8-15)19(21)20(24)22-13-16-11-12-23(14-16)18-5-3-2-4-6-18;;/h2-10,16,19H,11-14,21H2,1H3,(H,22,24);2*1H |
| InChIKey | MWEGEEZKMVSAOG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |