About N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride
N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 120671060) has the molecular formula C13H23ClN4O
and a molecular weight of 286.81 g/mol. Its IUPAC name is N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
| PubChem CID | 120671060 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCC2NCCCC2(C)C)n[nH]1.Cl |
| InChI | InChI=1S/C13H22N4O.ClH/c1-9-7-10(17-16-9)12(18)15-8-11-13(2,3)5-4-6-14-11;/h7,11,14H,4-6,8H2,1-3H3,(H,15,18)(H,16,17);1H |
| InChIKey | YUFDFZOVFCBKCA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride?
The IUPAC name of N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride (CID 120671060) is N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride.
What is the SMILES notation for N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride?
The canonical SMILES for N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride is Cc1cc(C(=O)NCC2NCCCC2(C)C)n[nH]1.Cl.
What is the InChIKey of N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride?
The InChIKey is YUFDFZOVFCBKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O.ClH/c1-9-7-10(17-16-9)12(18)15-8-11-13(2,3)5-4-6-14-11;/h7,11,14H,4-6,8H2,1-3H3,(H,15,18)(H,16,17);1H.
What are the key properties of N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride?
N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride has a molecular weight of 286.81 g/mol, XLogP of 1.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-dimethylpiperidin-2-yl)methyl]-5-methyl-1H-pyrazole-3-carboxamide;hydrochloride is sourced from PubChem (CID 120671060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).