About N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide
N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120671174) has the molecular formula C17H25N3O2
and a molecular weight of 303.41 g/mol. Its IUPAC name is N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide |
| PubChem CID | 120671174 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CCOc1cccc([C@@H]2C[C@H]2/N=C(\N)N2CCOC(C)C2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-21-14-6-4-5-13(9-14)15-10-16(15)19-17(18)20-7-8-22-12(2)11-20/h4-6,9,12,15-16H,3,7-8,10-11H2,1-2H3,(H2,18,19)/t12?,15-,16+/m0/s1 |
| InChIKey | PXXMQSOBOKAFGG-FFPFEORLSA-N |
| XLogP | 1.98 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide?
The IUPAC name of N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide (CID 120671174) is N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide?
The canonical SMILES for N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide is CCOc1cccc([C@@H]2C[C@H]2/N=C(\N)N2CCOC(C)C2)c1.
What is the InChIKey of N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide?
The InChIKey is PXXMQSOBOKAFGG-FFPFEORLSA-N. The full InChI is InChI=1S/C17H25N3O2/c1-3-21-14-6-4-5-13(9-14)15-10-16(15)19-17(18)20-7-8-22-12(2)11-20/h4-6,9,12,15-16H,3,7-8,10-11H2,1-2H3,(H2,18,19)/t12?,15-,16+/m0/s1.
What are the key properties of N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide?
N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide has a molecular weight of 303.41 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 120671174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).