C17H25N3O2 — CID 120671174
N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120671174) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120671174 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N'-[(1R,2S)-2-(3-ethoxyphenyl)cyclopropyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CCOc1cccc([C@@H]2C[C@H]2/N=C(\N)N2CCOC(C)C2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-21-14-6-4-5-13(9-14)15-10-16(15)19-17(18)20-7-8-22-12(2)11-20/h4-6,9,12,15-16H,3,7-8,10-11H2,1-2H3,(H2,18,19)/t12?,15-,16+/m0/s1 |
| InChIKey | PXXMQSOBOKAFGG-FFPFEORLSA-N |
| XLogP | 1.98 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|