C23H36FNO5 — CID 12067120
7-[(1R,2R,5S)-2-[(3R)-5-(2-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]heptanoic acid (PubChem CID 12067120) has the molecular formula C23H36FNO5 and a molecular weight of 425.54 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-5-(2-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-5-(2-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 12067120 |
| Molecular Formula | C23H36FNO5 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-5-(2-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(hydroxyamino)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1[C@@H](O)CC(NO)[C@@H]1CC[C@@H](O)CCc1ccccc1F |
| InChI | InChI=1S/C23H36FNO5/c24-20-9-6-5-7-16(20)11-12-17(26)13-14-18-19(22(27)15-21(18)25-30)8-3-1-2-4-10-23(28)29/h5-7,9,17-19,21-22,25-27,30H,1-4,8,10-15H2,(H,28,29)/t17-,18+,19+,21?,22-/m0/s1 |
| InChIKey | XDOBTWUSORORGN-ZXOZBQOJSA-N |
| XLogP | 3.67 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|