C19H22F2IN3 — CID 120671742
1-[3-(3,5-difluorophenyl)cyclobutyl]-2-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 120671742) has the molecular formula C19H22F2IN3 and a molecular weight of 457.31 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)cyclobutyl]-2-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-difluorophenyl)cyclobutyl]-2-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671742 |
| Molecular Formula | C19H22F2IN3 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)cyclobutyl]-2-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1ccccc1)NC1CC(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C19H21F2N3.HI/c20-16-8-14(9-17(21)12-16)15-10-18(11-15)24-19(22)23-7-6-13-4-2-1-3-5-13;/h1-5,8-9,12,15,18H,6-7,10-11H2,(H3,22,23,24);1H |
| InChIKey | JGWCBZRFNLVRJU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|