C21H34N2O4 — CID 120673013
4-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 120673013) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 4-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673013 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 4-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C21H34N2O4/c24-19(11-6-16-4-2-1-3-5-16)22-12-14-23(15-13-22)20(25)17-7-9-18(10-8-17)21(26)27/h16-18H,1-15H2,(H,26,27) |
| InChIKey | WPQIRYZAUIMYAO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |