C13H18F3NO3 — CID 120673099
4-[prop-2-enyl(2,2,2-trifluoroethyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673099) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-[prop-2-enyl(2,2,2-trifluoroethyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[prop-2-enyl(2,2,2-trifluoroethyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673099 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-[prop-2-enyl(2,2,2-trifluoroethyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | C=CCN(CC(F)(F)F)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H18F3NO3/c1-2-7-17(8-13(14,15)16)11(18)9-3-5-10(6-4-9)12(19)20/h2,9-10H,1,3-8H2,(H,19,20) |
| InChIKey | BPUKKXNBJQETKY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|