C20H26O6 — CID 12067312
(1S,3'aR,5R,6S,7R,7'aR,9S,11R)-7,11-dihydroxy-3'a-methyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,7'-4,5,6,7a-tetrahydro-3H-2-benzofuran]-1',2-dione (PubChem CID 12067312) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1S,3'aR,5R,6S,7R,7'aR,9S,11R)-7,11-dihydroxy-3'a-methyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,7'-4,5,6,7a-tetrahydro-3H-2-benzofuran]-1',2-dione.
| Compound Name | (1S,3'aR,5R,6S,7R,7'aR,9S,11R)-7,11-dihydroxy-3'a-methyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,7'-4,5,6,7a-tetrahydro-3H-2-benzofuran]-1',2-dione |
|---|---|
| PubChem CID | 12067312 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1S,3'aR,5R,6S,7R,7'aR,9S,11R)-7,11-dihydroxy-3'a-methyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,7'-4,5,6,7a-tetrahydro-3H-2-benzofuran]-1',2-dione |
| SMILES | C=C1[C@@H]2C[C@@H](O)[C@H]3[C@@]4(CCC[C@@]5(C)COC(=O)[C@H]54)COC(=O)[C@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C20H26O6/c1-10-11-6-12(21)13-19(9-26-17(24)20(13,7-11)15(10)22)5-3-4-18(2)8-25-16(23)14(18)19/h11-15,21-22H,1,3-9H2,2H3/t11-,12-,13+,14-,15-,18+,19-,20+/m1/s1 |
| InChIKey | BEOHZDZVHPQJNV-SJOQVHCZSA-N |
| XLogP | 1.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|