C18H25NO3S — CID 120673419
4-[(4-tert-butylsulfanylphenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673419) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-[(4-tert-butylsulfanylphenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-tert-butylsulfanylphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673419 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-[(4-tert-butylsulfanylphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)Sc1ccc(NC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-18(2,3)23-15-10-8-14(9-11-15)19-16(20)12-4-6-13(7-5-12)17(21)22/h8-13H,4-7H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | KYEUUIVSEAUGMG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |