C28H21NOS — CID 12067400
1-[5-(N-naphthalen-1-ylanilino)-4-phenylthiophen-2-yl]ethanone (PubChem CID 12067400) has the molecular formula C28H21NOS and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-[5-(N-naphthalen-1-ylanilino)-4-phenylthiophen-2-yl]ethanone.
| Compound Name | 1-[5-(N-naphthalen-1-ylanilino)-4-phenylthiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 12067400 |
| Molecular Formula | C28H21NOS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[5-(N-naphthalen-1-ylanilino)-4-phenylthiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccccc2)c(N(c2ccccc2)c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C28H21NOS/c1-20(30)27-19-25(22-11-4-2-5-12-22)28(31-27)29(23-15-6-3-7-16-23)26-18-10-14-21-13-8-9-17-24(21)26/h2-19H,1H3 |
| InChIKey | YZSIUDOAANWIPC-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |