C21H29NO5 — CID 120674625
4-[4-[(2-methoxyphenyl)methoxy]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 120674625) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[4-[(2-methoxyphenyl)methoxy]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[(2-methoxyphenyl)methoxy]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674625 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[4-[(2-methoxyphenyl)methoxy]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1COC1CCN(C(=O)C2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C21H29NO5/c1-26-19-5-3-2-4-17(19)14-27-18-10-12-22(13-11-18)20(23)15-6-8-16(9-7-15)21(24)25/h2-5,15-16,18H,6-14H2,1H3,(H,24,25) |
| InChIKey | ORYFSINEWPGFOD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |