C18H19F17O4S2 — CID 12067464
[1-(3,3-dimethyl-2-oxobutyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 12067464) has the molecular formula C18H19F17O4S2 and a molecular weight of 686.45 g/mol. Its IUPAC name is [1-(3,3-dimethyl-2-oxobutyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [1-(3,3-dimethyl-2-oxobutyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 12067464 |
| Molecular Formula | C18H19F17O4S2 |
| Molecular Weight | 686.45 g/mol |
| Exact Mass | 686.05 |
| IUPAC Name | [1-(3,3-dimethyl-2-oxobutyl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CC(C)(C)C(=O)CS1(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C18H19F17O4S2/c1-10(2,3)9(36)8-40(6-4-5-7-40)39-41(37,38)18(34,35)16(29,30)14(25,26)12(21,22)11(19,20)13(23,24)15(27,28)17(31,32)33/h4-8H2,1-3H3 |
| InChIKey | DQACSKDEJXMCFM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.45 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|