C19H26N2O5 — CID 120675480
cis-(1S,3R)-3-[4-[(2-ethoxybenzoyl)amino]butanoylamino]cyclopentane-1-carboxylic acid (PubChem CID 120675480) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is cis-(1S,3R)-3-[4-[(2-ethoxybenzoyl)amino]butanoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[4-[(2-ethoxybenzoyl)amino]butanoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120675480 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | cis-(1S,3R)-3-[4-[(2-ethoxybenzoyl)amino]butanoylamino]cyclopentane-1-carboxylic acid |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)N[C@@H]1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C19H26N2O5/c1-2-26-16-7-4-3-6-15(16)18(23)20-11-5-8-17(22)21-14-10-9-13(12-14)19(24)25/h3-4,6-7,13-14H,2,5,8-12H2,1H3,(H,20,23)(H,21,22)(H,24,25)/t13-,14+/m0/s1 |
| InChIKey | RIPBSXDVQJKNHC-UONOGXRCSA-N |
| XLogP | 1.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|