About (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one
(1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one (PubChem CID 1206757) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one.
Molecular Properties
| Compound Name | (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one |
| PubChem CID | 1206757 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one |
| SMILES | CC(=O)/C(=C1/NC(C)(C)Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-14(22)18(15-9-5-4-6-10-15)19-17-12-8-7-11-16(17)13-20(2,3)21-19/h4-12,21H,13H2,1-3H3/b19-18- |
| InChIKey | LHPRAQSNLIARHG-HNENSFHCSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one?
The IUPAC name of (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one (CID 1206757) is (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one.
What is the SMILES notation for (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one?
The canonical SMILES for (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one is CC(=O)/C(=C1/NC(C)(C)Cc2ccccc21)c1ccccc1.
What is the InChIKey of (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one?
The InChIKey is LHPRAQSNLIARHG-HNENSFHCSA-N. The full InChI is InChI=1S/C20H21NO/c1-14(22)18(15-9-5-4-6-10-15)19-17-12-8-7-11-16(17)13-20(2,3)21-19/h4-12,21H,13H2,1-3H3/b19-18-.
What are the key properties of (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one?
(1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one has a molecular weight of 291.39 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylpropan-2-one is sourced from PubChem (CID 1206757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).