C15H18N2O7 — CID 120677851
cis-(1R,3S)-3-[[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120677851) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120677851 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | cis-(1R,3S)-3-[[2-(3-methoxy-4-nitrophenoxy)acetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | COc1cc(OCC(=O)N[C@H]2CC[C@@H](C(=O)O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O7/c1-23-13-7-11(4-5-12(13)17(21)22)24-8-14(18)16-10-3-2-9(6-10)15(19)20/h4-5,7,9-10H,2-3,6,8H2,1H3,(H,16,18)(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | UHTRDOXJJJYAJP-ZJUUUORDSA-N |
| XLogP | 1.35 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|