C16H18F3NO5S — CID 120679593
(3aS,6aR)-2-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120679593) has the molecular formula C16H18F3NO5S and a molecular weight of 393.38 g/mol. Its IUPAC name is (3aS,6aR)-2-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120679593 |
| Molecular Formula | C16H18F3NO5S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (3aS,6aR)-2-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(S(=O)(=O)c1ccc(OCC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C16H18F3NO5S/c17-16(18,19)10-25-12-3-5-13(6-4-12)26(23,24)20-8-11-2-1-7-15(11,9-20)14(21)22/h3-6,11H,1-2,7-10H2,(H,21,22)/t11-,15+/m0/s1 |
| InChIKey | JYZHDAARSGGYJY-XHDPSFHLSA-N |
| XLogP | 2.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |