C11H16F3NO2 — CID 120680045
(3aS,6aR)-2-(3,3,3-trifluoropropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120680045) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is (3aS,6aR)-2-(3,3,3-trifluoropropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(3,3,3-trifluoropropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120680045 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (3aS,6aR)-2-(3,3,3-trifluoropropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(CCC(F)(F)F)C2 |
| InChI | InChI=1S/C11H16F3NO2/c12-11(13,14)4-5-15-6-8-2-1-3-10(8,7-15)9(16)17/h8H,1-7H2,(H,16,17)/t8-,10+/m0/s1 |
| InChIKey | LZDDHAMTUHXZBC-WCBMZHEXSA-N |
| XLogP | 2.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |