C19H25ClN2O3 — CID 120680290
(3aS,6aR)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680290) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680290 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3aS,6aR)-2-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | CC1Cc2ccccc2N1C(=O)CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-13-9-14-5-2-3-7-16(14)21(13)17(22)11-20-10-15-6-4-8-19(15,12-20)18(23)24;/h2-3,5,7,13,15H,4,6,8-12H2,1H3,(H,23,24);1H/t13?,15-,19+;/m0./s1 |
| InChIKey | ULGZKSPWFHMXBZ-YLTZVKSWSA-N |
| XLogP | 2.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |