C10H14F3NO2 — CID 120680898
(3aS,6aR)-2-(2,2,2-trifluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120680898) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,2,2-trifluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(2,2,2-trifluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120680898 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3aS,6aR)-2-(2,2,2-trifluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(CC(F)(F)F)C2 |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)6-14-4-7-2-1-3-9(7,5-14)8(15)16/h7H,1-6H2,(H,15,16)/t7-,9+/m0/s1 |
| InChIKey | QEGGSAUAGLPYRK-IONNQARKSA-N |
| XLogP | 1.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |