C18H26ClN3O5S — CID 120681378
(3aS,6aR)-2-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120681378) has the molecular formula C18H26ClN3O5S and a molecular weight of 431.94 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120681378 |
| Molecular Formula | C18H26ClN3O5S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3aS,6aR)-2-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)CN2C[C@@H]3CCC[C@@]3(C(=O)O)C2)ccc1C.Cl |
| InChI | InChI=1S/C18H25N3O5S.ClH/c1-12-5-6-14(8-15(12)27(25,26)19-2)20-16(22)10-21-9-13-4-3-7-18(13,11-21)17(23)24;/h5-6,8,13,19H,3-4,7,9-11H2,1-2H3,(H,20,22)(H,23,24);1H/t13-,18+;/m0./s1 |
| InChIKey | YXECYBLBCUBYFG-UFRBEDTPSA-N |
| XLogP | 1.45 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |