C16H23N3O3 — CID 120682406
(3aS,6aR)-2-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120682406) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3aS,6aR)-2-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120682406 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3aS,6aR)-2-(1-ethyl-3,5-dimethylpyrazole-4-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CCn1nc(C)c(C(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)c1C |
| InChI | InChI=1S/C16H23N3O3/c1-4-19-11(3)13(10(2)17-19)14(20)18-8-12-6-5-7-16(12,9-18)15(21)22/h12H,4-9H2,1-3H3,(H,21,22)/t12-,16+/m0/s1 |
| InChIKey | CXZXBMWVVCKYAI-BLLLJJGKSA-N |
| XLogP | 1.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |