C20H27NO4 — CID 120682459
(3aS,6aR)-2-[5-(3-methylphenoxy)pentanoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120682459) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (3aS,6aR)-2-[5-(3-methylphenoxy)pentanoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[5-(3-methylphenoxy)pentanoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120682459 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (3aS,6aR)-2-[5-(3-methylphenoxy)pentanoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cccc(OCCCCC(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)c1 |
| InChI | InChI=1S/C20H27NO4/c1-15-6-4-8-17(12-15)25-11-3-2-9-18(22)21-13-16-7-5-10-20(16,14-21)19(23)24/h4,6,8,12,16H,2-3,5,7,9-11,13-14H2,1H3,(H,23,24)/t16-,20+/m0/s1 |
| InChIKey | SPJYURWEEHLTRE-OXJNMPFZSA-N |
| XLogP | 3.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|