C16H16N4O5 — CID 120683028
(3aS,6aR)-2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120683028) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120683028 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (3aS,6aR)-2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(c1cnc2[nH]c(=O)[nH]c(=O)c2c1)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H16N4O5/c21-12-10-4-8(5-17-11(10)18-15(25)19-12)13(22)20-6-9-2-1-3-16(9,7-20)14(23)24/h4-5,9H,1-3,6-7H2,(H,23,24)(H2,17,18,19,21,25)/t9-,16+/m0/s1 |
| InChIKey | BEWWFJOHLNBVHE-XXFAHNHDSA-N |
| XLogP | -0.06 |
| TPSA | 136.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |