C16H19N3O5 — CID 120683809
(3aS,6aR)-2-[2-(2-nitroanilino)acetyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120683809) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(2-nitroanilino)acetyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[2-(2-nitroanilino)acetyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120683809 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (3aS,6aR)-2-[2-(2-nitroanilino)acetyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(CNc1ccccc1[N+](=O)[O-])N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H19N3O5/c20-14(8-17-12-5-1-2-6-13(12)19(23)24)18-9-11-4-3-7-16(11,10-18)15(21)22/h1-2,5-6,11,17H,3-4,7-10H2,(H,21,22)/t11-,16+/m0/s1 |
| InChIKey | FBXPCCUGEYSRQV-MEDUHNTESA-N |
| XLogP | 1.72 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|