C17H17ClN2O4 — CID 120684101
2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(2-nitrophenyl)methyl]ethanamine (PubChem CID 120684101) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(2-nitrophenyl)methyl]ethanamine.
| Compound Name | 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(2-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 120684101 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[(2-nitrophenyl)methyl]ethanamine |
| SMILES | O=[N+]([O-])c1ccccc1CNCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C17H17ClN2O4/c18-14-9-12(10-16-17(14)24-8-7-23-16)5-6-19-11-13-3-1-2-4-15(13)20(21)22/h1-4,9-10,19H,5-8,11H2 |
| InChIKey | IDSZSZYIWZVOGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|